C30H46N2O6 — CID 163162488
methyl (1aS,7aR)-7a-[(5S)-5-(2-aminopiperidin-4-yl)-6-(4-hydroxycyclohexyl)-3-methylhex-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163162488) has the molecular formula C30H46N2O6 and a molecular weight of 530.71 g/mol. Its IUPAC name is methyl (1aS,7aR)-7a-[(5S)-5-(2-aminopiperidin-4-yl)-6-(4-hydroxycyclohexyl)-3-methylhex-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | methyl (1aS,7aR)-7a-[(5S)-5-(2-aminopiperidin-4-yl)-6-(4-hydroxycyclohexyl)-3-methylhex-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163162488 |
| Molecular Formula | C30H46N2O6 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | methyl (1aS,7aR)-7a-[(5S)-5-(2-aminopiperidin-4-yl)-6-(4-hydroxycyclohexyl)-3-methylhex-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | COC(=O)[C@]12O[C@@]1(CC=C(C)C[C@H](CC1CCC(O)CC1)C1CCNC(N)C1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C30H46N2O6/c1-18(15-21(20-12-14-32-25(31)17-20)16-19-7-9-22(33)10-8-19)11-13-29-26(34)23-5-3-4-6-24(23)27(35)30(29,38-29)28(36)37-2/h11,19-25,32-33H,3-10,12-17,31H2,1-2H3/t19?,20?,21-,22?,23?,24?,25?,29+,30+/m1/s1 |
| InChIKey | BRYSPOOQEWSLNW-MZRNXRJGSA-N |
| XLogP | 3.19 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|