C28H45N2O5+ — CID 163140105
hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163140105) has the molecular formula C28H45N2O5+ and a molecular weight of 489.68 g/mol. Its IUPAC name is hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163140105 |
| Molecular Formula | C28H45N2O5+ |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)[C@]12O[C@@]1(CC=C(C)CCC1CC[NH2+]C(N)C1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C28H44N2O5/c1-3-4-5-8-17-34-26(33)28-25(32)22-10-7-6-9-21(22)24(31)27(28,35-28)15-13-19(2)11-12-20-14-16-30-23(29)18-20/h13,20-23,30H,3-12,14-18,29H2,1-2H3/p+1/t20?,21?,22?,23?,27-,28-/m0/s1 |
| InChIKey | AHJFIDNRVPWROZ-BTHOXAQSSA-O |
| XLogP | 2.95 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|