C27H31NO5 — CID 163166573
hexyl 7a-[3-methyl-5-(2H-pyrrol-4-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163166573) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is hexyl 7a-[3-methyl-5-(2H-pyrrol-4-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl 7a-[3-methyl-5-(2H-pyrrol-4-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163166573 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | hexyl 7a-[3-methyl-5-(2H-pyrrol-4-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)C12OC1(CC=C(C)CCC1=CCN=C1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H31NO5/c1-3-4-5-8-17-32-25(31)27-24(30)22-10-7-6-9-21(22)23(29)26(27,33-27)15-13-19(2)11-12-20-14-16-28-18-20/h6-7,9-10,13-14,18H,3-5,8,11-12,15-17H2,1-2H3 |
| InChIKey | SYPMAFZKTAXZAX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 85.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|