C26H34O5 — CID 162824035
hexyl 7a-(3-methylbut-2-enyl)-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162824035) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is hexyl 7a-(3-methylbut-2-enyl)-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl 7a-(3-methylbut-2-enyl)-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162824035 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | hexyl 7a-(3-methylbut-2-enyl)-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)C12OC1(CC=C(C)C)C(=O)c1cccc(CC(C)C)c1C2=O |
| InChI | InChI=1S/C26H34O5/c1-6-7-8-9-15-30-24(29)26-23(28)21-19(16-18(4)5)11-10-12-20(21)22(27)25(26,31-26)14-13-17(2)3/h10-13,18H,6-9,14-16H2,1-5H3 |
| InChIKey | SRVSLLQIKQGUMY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|