C35H38N2O6 — CID 162793968
hexyl (1aS,7aR)-7a-[(E,5R)-5-(2-amino-4-pyridinyl)-6-(4-hydroxyphenyl)-3-methylhex-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162793968) has the molecular formula C35H38N2O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is hexyl (1aS,7aR)-7a-[(E,5R)-5-(2-amino-4-pyridinyl)-6-(4-hydroxyphenyl)-3-methylhex-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl (1aS,7aR)-7a-[(E,5R)-5-(2-amino-4-pyridinyl)-6-(4-hydroxyphenyl)-3-methylhex-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162793968 |
| Molecular Formula | C35H38N2O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | hexyl (1aS,7aR)-7a-[(E,5R)-5-(2-amino-4-pyridinyl)-6-(4-hydroxyphenyl)-3-methylhex-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)[C@]12O[C@@]1(C/C=C(\C)C[C@H](Cc1ccc(O)cc1)c1ccnc(N)c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H38N2O6/c1-3-4-5-8-19-42-33(41)35-32(40)29-10-7-6-9-28(29)31(39)34(35,43-35)17-15-23(2)20-26(25-16-18-37-30(36)22-25)21-24-11-13-27(38)14-12-24/h6-7,9-16,18,22,26,38H,3-5,8,17,19-21H2,1-2H3,(H2,36,37)/b23-15+/t26-,34+,35+/m1/s1 |
| InChIKey | PKLRLUPUGKLTEO-NZSBRXCESA-N |
| XLogP | 6.13 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|