C27H31NO5 — CID 162991133
hexyl (1aS,7aR)-7a-[(E)-3-methyl-5-(1H-pyrrol-3-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162991133) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is hexyl (1aS,7aR)-7a-[(E)-3-methyl-5-(1H-pyrrol-3-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl (1aS,7aR)-7a-[(E)-3-methyl-5-(1H-pyrrol-3-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162991133 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | hexyl (1aS,7aR)-7a-[(E)-3-methyl-5-(1H-pyrrol-3-yl)pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)[C@]12O[C@@]1(C/C=C(\C)CCc1cc[nH]c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H31NO5/c1-3-4-5-8-17-32-25(31)27-24(30)22-10-7-6-9-21(22)23(29)26(27,33-27)15-13-19(2)11-12-20-14-16-28-18-20/h6-7,9-10,13-14,16,18,28H,3-5,8,11-12,15,17H2,1-2H3/b19-13+/t26-,27-/m0/s1 |
| InChIKey | BVQBMNMDOQNXRW-IDBUQCOESA-N |
| XLogP | 4.99 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|