C30H39N5O5 — CID 163136796
hexyl (1aS,7aR)-7a-[(E,5R)-5-(6-amino-1,2-dihydropyridin-4-yl)-3-methyl-5-[(N'-methylcarbamimidoyl)amino]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163136796) has the molecular formula C30H39N5O5 and a molecular weight of 549.67 g/mol. Its IUPAC name is hexyl (1aS,7aR)-7a-[(E,5R)-5-(6-amino-1,2-dihydropyridin-4-yl)-3-methyl-5-[(N'-methylcarbamimidoyl)amino]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl (1aS,7aR)-7a-[(E,5R)-5-(6-amino-1,2-dihydropyridin-4-yl)-3-methyl-5-[(N'-methylcarbamimidoyl)amino]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163136796 |
| Molecular Formula | C30H39N5O5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | hexyl (1aS,7aR)-7a-[(E,5R)-5-(6-amino-1,2-dihydropyridin-4-yl)-3-methyl-5-[(N'-methylcarbamimidoyl)amino]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)[C@]12O[C@@]1(C/C=C(\C)C[C@@H](N/C(N)=N/C)C1=CCNC(N)=C1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H39N5O5/c1-4-5-6-9-16-39-27(38)30-26(37)22-11-8-7-10-21(22)25(36)29(30,40-30)14-12-19(2)17-23(35-28(32)33-3)20-13-15-34-24(31)18-20/h7-8,10-13,18,23,34H,4-6,9,14-17,31H2,1-3H3,(H3,32,33,35)/b19-12+/t23-,29+,30+/m1/s1 |
| InChIKey | IGBCJMVSPJZHAM-OAIIQPQTSA-N |
| XLogP | 2.66 |
| TPSA | 161.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|