C36H49N3O6 — CID 162793606
2-(ethylaminomethyl)hexyl 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162793606) has the molecular formula C36H49N3O6 and a molecular weight of 619.80 g/mol. Its IUPAC name is 2-(ethylaminomethyl)hexyl 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | 2-(ethylaminomethyl)hexyl 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162793606 |
| Molecular Formula | C36H49N3O6 |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.36 |
| IUPAC Name | 2-(ethylaminomethyl)hexyl 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCC(CNCC)COC(=O)C12OC1(CC(CO)=C(C)CCc1ccnc(N)c1)C(=O)c1cccc(CC(C)C)c1C2=O |
| InChI | InChI=1S/C36H49N3O6/c1-6-8-10-26(20-38-7-2)22-44-34(43)36-33(42)31-27(17-23(3)4)11-9-12-29(31)32(41)35(36,45-36)19-28(21-40)24(5)13-14-25-15-16-39-30(37)18-25/h9,11-12,15-16,18,23,26,38,40H,6-8,10,13-14,17,19-22H2,1-5H3,(H2,37,39) |
| InChIKey | RWNALMGDSUIKJM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|