C23H22N2O5 — CID 162794785
methyl (1aS,7aR)-7a-[(E)-5-(2-amino-4-pyridinyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162794785) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl (1aS,7aR)-7a-[(E)-5-(2-amino-4-pyridinyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | methyl (1aS,7aR)-7a-[(E)-5-(2-amino-4-pyridinyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162794785 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | methyl (1aS,7aR)-7a-[(E)-5-(2-amino-4-pyridinyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | COC(=O)[C@]12O[C@@]1(C/C=C(\C)CCc1ccnc(N)c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H22N2O5/c1-14(7-8-15-10-12-25-18(24)13-15)9-11-22-19(26)16-5-3-4-6-17(16)20(27)23(22,30-22)21(28)29-2/h3-6,9-10,12-13H,7-8,11H2,1-2H3,(H2,24,25)/b14-9+/t22-,23-/m0/s1 |
| InChIKey | STYAUVWSJJMHDS-ZXARYOAHSA-N |
| XLogP | 2.69 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|