C27H31N3O7 — CID 162791927
2-hydroxyethyl 7a-[2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162791927) has the molecular formula C27H31N3O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-hydroxyethyl 7a-[2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | 2-hydroxyethyl 7a-[2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162791927 |
| Molecular Formula | C27H31N3O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-hydroxyethyl 7a-[2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CNCNc1cc(CCC(C)=C(CO)CC23OC2(C(=O)OCCO)C(=O)c2ccccc2C3=O)ccn1 |
| InChI | InChI=1S/C27H31N3O7/c1-17(7-8-18-9-10-29-22(13-18)30-16-28-2)19(15-32)14-26-23(33)20-5-3-4-6-21(20)24(34)27(26,37-26)25(35)36-12-11-31/h3-6,9-10,13,28,31-32H,7-8,11-12,14-16H2,1-2H3,(H,29,30) |
| InChIKey | QXRGUIACCSSTAS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 150.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|