C26H29N3O6 — CID 162809271
methyl (1aS,7aR)-7a-[(Z)-2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162809271) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is methyl (1aS,7aR)-7a-[(Z)-2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | methyl (1aS,7aR)-7a-[(Z)-2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162809271 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | methyl (1aS,7aR)-7a-[(Z)-2-(hydroxymethyl)-3-methyl-5-[2-(methylaminomethylamino)-4-pyridinyl]pent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CNCNc1cc(CC/C(C)=C(\CO)C[C@@]23O[C@]2(C(=O)OC)C(=O)c2ccccc2C3=O)ccn1 |
| InChI | InChI=1S/C26H29N3O6/c1-16(8-9-17-10-11-28-21(12-17)29-15-27-2)18(14-30)13-25-22(31)19-6-4-5-7-20(19)23(32)26(25,35-25)24(33)34-3/h4-7,10-12,27,30H,8-9,13-15H2,1-3H3,(H,28,29)/b18-16-/t25-,26-/m0/s1 |
| InChIKey | HXVICMRFRYCESY-GMFMHPDQSA-N |
| XLogP | 2.06 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|