C35H47N3O7 — CID 162793979
[5-(ethylaminomethyl)-1-hydroxynonan-4-yl] 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 162793979) has the molecular formula C35H47N3O7 and a molecular weight of 621.78 g/mol. Its IUPAC name is [5-(ethylaminomethyl)-1-hydroxynonan-4-yl] 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | [5-(ethylaminomethyl)-1-hydroxynonan-4-yl] 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 162793979 |
| Molecular Formula | C35H47N3O7 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | [5-(ethylaminomethyl)-1-hydroxynonan-4-yl] 7a-[5-(2-amino-4-pyridinyl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCC(CNCC)C(CCCO)OC(=O)C12OC1(CC(CO)=C(C)CCc1ccnc(N)c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H47N3O7/c1-4-6-10-25(21-37-5-2)29(13-9-18-39)44-33(43)35-32(42)28-12-8-7-11-27(28)31(41)34(35,45-35)20-26(22-40)23(3)14-15-24-16-17-38-30(36)19-24/h7-8,11-12,16-17,19,25,29,37,39-40H,4-6,9-10,13-15,18,20-22H2,1-3H3,(H2,36,38) |
| InChIKey | KHKSFMDJYKUGMX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|