C30H36N2O7 — CID 163170185
2-hydroxyethyl (1aS,7aR)-7a-[(Z)-4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163170185) has the molecular formula C30H36N2O7 and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-hydroxyethyl (1aS,7aR)-7a-[(Z)-4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | 2-hydroxyethyl (1aS,7aR)-7a-[(Z)-4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163170185 |
| Molecular Formula | C30H36N2O7 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 2-hydroxyethyl (1aS,7aR)-7a-[(Z)-4-[1-(6-amino-1,2-dihydropyridin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxonaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | C/C(CC1(C2=CCNC(N)=C2)CCCCC1)=C(/CO)C[C@@]12O[C@]1(C(=O)OCCO)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H36N2O7/c1-19(16-28(10-5-2-6-11-28)21-9-12-32-24(31)15-21)20(18-34)17-29-25(35)22-7-3-4-8-23(22)26(36)30(29,39-29)27(37)38-14-13-33/h3-4,7-9,15,32-34H,2,5-6,10-14,16-18,31H2,1H3/b20-19-/t29-,30-/m0/s1 |
| InChIKey | VBCGWFXDCAGDJE-BFICSWAHSA-N |
| XLogP | 2.48 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|