C33H55N5O5+2 — CID 163132893
[4-[4-(1a-hexoxycarbonyl-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl)-2-methylbut-2-enyl]-4-(2-aminopiperidin-1-ium-4-yl)-1,3-diazepan-2-ylidene]-methylazanium (PubChem CID 163132893) has the molecular formula C33H55N5O5+2 and a molecular weight of 601.83 g/mol. Its IUPAC name is [4-[4-(1a-hexoxycarbonyl-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl)-2-methylbut-2-enyl]-4-(2-aminopiperidin-1-ium-4-yl)-1,3-diazepan-2-ylidene]-methylazanium.
| Compound Name | [4-[4-(1a-hexoxycarbonyl-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl)-2-methylbut-2-enyl]-4-(2-aminopiperidin-1-ium-4-yl)-1,3-diazepan-2-ylidene]-methylazanium |
|---|---|
| PubChem CID | 163132893 |
| Molecular Formula | C33H55N5O5+2 |
| Molecular Weight | 601.83 g/mol |
| Exact Mass | 601.42 |
| IUPAC Name | [4-[4-(1a-hexoxycarbonyl-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl)-2-methylbut-2-enyl]-4-(2-aminopiperidin-1-ium-4-yl)-1,3-diazepan-2-ylidene]-methylazanium |
| SMILES | CCCCCCOC(=O)C12OC1(CC=C(C)CC1(C3CC[NH2+]C(N)C3)CCCN/C(=[NH+]\C)N1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C33H53N5O5/c1-4-5-6-9-19-42-29(41)33-28(40)25-12-8-7-11-24(25)27(39)32(33,43-33)16-13-22(2)21-31(23-14-18-36-26(34)20-23)15-10-17-37-30(35-3)38-31/h13,23-26,36H,4-12,14-21,34H2,1-3H3,(H2,35,37,38)/p+2 |
| InChIKey | ZRTCPOVGGXYKLY-UHFFFAOYSA-P |
| XLogP | 0.34 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.83 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|