C28H47N5O6+2 — CID 163117260
[[[5-[1a-(4-hydroxybutoxycarbonyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl]-1-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-3-enyl]amino]-aminomethylidene]-methylazanium (PubChem CID 163117260) has the molecular formula C28H47N5O6+2 and a molecular weight of 549.71 g/mol. Its IUPAC name is [[[5-[1a-(4-hydroxybutoxycarbonyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl]-1-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-3-enyl]amino]-aminomethylidene]-methylazanium.
| Compound Name | [[[5-[1a-(4-hydroxybutoxycarbonyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl]-1-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-3-enyl]amino]-aminomethylidene]-methylazanium |
|---|---|
| PubChem CID | 163117260 |
| Molecular Formula | C28H47N5O6+2 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | [[[5-[1a-(4-hydroxybutoxycarbonyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxiren-7a-yl]-1-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-3-enyl]amino]-aminomethylidene]-methylazanium |
| SMILES | C/[NH+]=C(\N)NC(CC(C)=CCC12OC1(C(=O)OCCCCO)C(=O)C1CCCCC1C2=O)C1CC[NH2+]C(N)C1 |
| InChI | InChI=1S/C28H45N5O6/c1-17(15-21(33-26(30)31-2)18-10-12-32-22(29)16-18)9-11-27-23(35)19-7-3-4-8-20(19)24(36)28(27,39-27)25(37)38-14-6-5-13-34/h9,18-22,32,34H,3-8,10-16,29H2,1-2H3,(H3,30,31,33)/p+2 |
| InChIKey | GJHMLZLYHCDAOB-UHFFFAOYSA-P |
| XLogP | -2.26 |
| TPSA | 187.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|