C32H55N3O6+2 — CID 163167024
2-[[7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carbonyl]oxymethyl]hexyl-ethylazanium (PubChem CID 163167024) has the molecular formula C32H55N3O6+2 and a molecular weight of 577.81 g/mol. Its IUPAC name is 2-[[7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carbonyl]oxymethyl]hexyl-ethylazanium.
| Compound Name | 2-[[7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carbonyl]oxymethyl]hexyl-ethylazanium |
|---|---|
| PubChem CID | 163167024 |
| Molecular Formula | C32H55N3O6+2 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.41 |
| IUPAC Name | 2-[[7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carbonyl]oxymethyl]hexyl-ethylazanium |
| SMILES | CCCCC(C[NH2+]CC)COC(=O)C12OC1(CC(CO)=C(C)CCC1CC[NH2+]C(N)C1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C32H53N3O6/c1-4-6-9-23(18-34-5-2)20-40-30(39)32-29(38)26-11-8-7-10-25(26)28(37)31(32,41-32)17-24(19-36)21(3)12-13-22-14-15-35-27(33)16-22/h22-23,25-27,34-36H,4-20,33H2,1-3H3/p+2 |
| InChIKey | FYIJMMQJIJFWHN-UHFFFAOYSA-P |
| XLogP | 1.12 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|