C37H61N3O7 — CID 163136891
[1-[5-ethyl-2-(ethylamino)cyclohexyl]-4-hydroxybutyl] 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163136891) has the molecular formula C37H61N3O7 and a molecular weight of 659.91 g/mol. Its IUPAC name is [1-[5-ethyl-2-(ethylamino)cyclohexyl]-4-hydroxybutyl] 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | [1-[5-ethyl-2-(ethylamino)cyclohexyl]-4-hydroxybutyl] 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163136891 |
| Molecular Formula | C37H61N3O7 |
| Molecular Weight | 659.91 g/mol |
| Exact Mass | 659.45 |
| IUPAC Name | [1-[5-ethyl-2-(ethylamino)cyclohexyl]-4-hydroxybutyl] 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCNC1CCC(CC)CC1C(CCCO)OC(=O)C12OC1(CC(CO)=C(C)CCC1CCNC(N)C1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C37H61N3O7/c1-4-24-14-15-30(39-5-2)29(19-24)31(11-8-18-41)46-35(45)37-34(44)28-10-7-6-9-27(28)33(43)36(37,47-37)21-26(22-42)23(3)12-13-25-16-17-40-32(38)20-25/h24-25,27-32,39-42H,4-22,38H2,1-3H3 |
| InChIKey | MPDLORBYCNBMAE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|