C11H12ClN3O6 — CID 163158738
4-chloro-6-[(1R)-1-cyano-2-ethoxy-2-oxoethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163158738) has the molecular formula C11H12ClN3O6 and a molecular weight of 317.69 g/mol. Its IUPAC name is 4-chloro-6-[(1R)-1-cyano-2-ethoxy-2-oxoethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 4-chloro-6-[(1R)-1-cyano-2-ethoxy-2-oxoethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163158738 |
| Molecular Formula | C11H12ClN3O6 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-chloro-6-[(1R)-1-cyano-2-ethoxy-2-oxoethyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | CCOC(=O)[C@@H](C#N)c1cc(Cl)c([NH+]([O-])O)cc1[NH+]([O-])O |
| InChI | InChI=1S/C11H12ClN3O6/c1-2-21-11(16)7(5-13)6-3-8(12)10(15(19)20)4-9(6)14(17)18/h3-4,7,14-15,17,19H,2H2,1H3/t7-/m0/s1 |
| InChIKey | QERCAFDQOZSGBO-ZETCQYMHSA-N |
| XLogP | -0.68 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|