C13H8ClN4O3S- — CID 163159029
2-chloro-N-[6-[hydroxy(oxido)amino]-1,3-benzothiazol-2-yl]pyridine-3-carboxamide (PubChem CID 163159029) has the molecular formula C13H8ClN4O3S- and a molecular weight of 335.75 g/mol. Its IUPAC name is 2-chloro-N-[6-[hydroxy(oxido)amino]-1,3-benzothiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[6-[hydroxy(oxido)amino]-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163159029 |
| Molecular Formula | C13H8ClN4O3S- |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-chloro-N-[6-[hydroxy(oxido)amino]-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(N([O-])O)cc2s1)c1cccnc1Cl |
| InChI | InChI=1S/C13H8ClN4O3S/c14-11-8(2-1-5-15-11)12(19)17-13-16-9-4-3-7(18(20)21)6-10(9)22-13/h1-6,20H,(H,16,17,19)/q-1 |
| InChIKey | SUTOSQJETLTFCJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|