C29H52O12 — CID 163162755
[(2R,3S,4S,5R,6R)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl (2R)-2-methylbutanoate (PubChem CID 163162755) has the molecular formula C29H52O12 and a molecular weight of 592.72 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl (2R)-2-methylbutanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163162755 |
| Molecular Formula | C29H52O12 |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-3,4-dihydroxy-6-octoxyoxan-2-yl]methyl (2R)-2-methylbutanoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](COC(=O)[C@H](C)CC)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](OC(=O)C(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H52O12/c1-7-9-10-11-12-13-14-36-29-25(21(31)20(30)19(39-29)15-37-27(35)17(5)8-2)41-28-23(33)22(32)24(18(6)38-28)40-26(34)16(3)4/h16-25,28-33H,7-15H2,1-6H3/t17-,18+,19-,20-,21+,22+,23-,24+,25-,28+,29-/m1/s1 |
| InChIKey | ROMBWQMOXPQRQK-SWWKFHONSA-N |
| XLogP | 1.82 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|