C9H19N3 — CID 163165908
1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3,4-diamine (PubChem CID 163165908) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3,4-diamine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3,4-diamine |
|---|---|
| PubChem CID | 163165908 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3,4-diamine |
| SMILES | NC1CNC2CCCCC2C1N |
| InChI | InChI=1S/C9H19N3/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h6-9,12H,1-5,10-11H2 |
| InChIKey | WULMCFZIEVDDIG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |