C10H19NO — CID 170906267
3-(methoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 170906267) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 3-(methoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 170906267 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-(methoxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | COCC1CNC2CCCCC12 |
| InChI | InChI=1S/C10H19NO/c1-12-7-8-6-11-10-5-3-2-4-9(8)10/h8-11H,2-7H2,1H3 |
| InChIKey | AAXFMSARVWQVJL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |