C13H25N3 — CID 163181241
2-methyl-3,4,4a,5,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-benzo[b][1,6]naphthyridin-10-amine (PubChem CID 163181241) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-benzo[b][1,6]naphthyridin-10-amine.
| Compound Name | 2-methyl-3,4,4a,5,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-benzo[b][1,6]naphthyridin-10-amine |
|---|---|
| PubChem CID | 163181241 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-methyl-3,4,4a,5,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-benzo[b][1,6]naphthyridin-10-amine |
| SMILES | CN1CCC2NC3CCCCC3C(N)C2C1 |
| InChI | InChI=1S/C13H25N3/c1-16-7-6-12-10(8-16)13(14)9-4-2-3-5-11(9)15-12/h9-13,15H,2-8,14H2,1H3 |
| InChIKey | MXSRMIJXHZUZII-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |