C15H26O2 — CID 163169635
11-hydroxy-2,10,10-trimethyldodeca-6,8-dien-3-one (PubChem CID 163169635) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 11-hydroxy-2,10,10-trimethyldodeca-6,8-dien-3-one.
| Compound Name | 11-hydroxy-2,10,10-trimethyldodeca-6,8-dien-3-one |
|---|---|
| PubChem CID | 163169635 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 11-hydroxy-2,10,10-trimethyldodeca-6,8-dien-3-one |
| SMILES | CC(C)C(=O)CCC=CC=CC(C)(C)C(C)O |
| InChI | InChI=1S/C15H26O2/c1-12(2)14(17)10-8-6-7-9-11-15(4,5)13(3)16/h6-7,9,11-13,16H,8,10H2,1-5H3 |
| InChIKey | UVKLYJFZSSUNQM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|