C33H45N3O8 — CID 163179244
5-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-methoxy-3-oxopropyl]-N,2-dihydroxybenzeneamine oxide (PubChem CID 163179244) has the molecular formula C33H45N3O8 and a molecular weight of 611.74 g/mol. Its IUPAC name is 5-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-methoxy-3-oxopropyl]-N,2-dihydroxybenzeneamine oxide.
| Compound Name | 5-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-methoxy-3-oxopropyl]-N,2-dihydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163179244 |
| Molecular Formula | C33H45N3O8 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | 5-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-3-methoxy-3-oxopropyl]-N,2-dihydroxybenzeneamine oxide |
| SMILES | COC(=O)C(Cc1ccc(O)c([NH+]([O-])O)c1)NC(=O)CON=C1C=C2CCC3C(CCC4(C)C(C(C)=O)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C33H45N3O8/c1-19(37)24-8-9-25-23-7-6-21-17-22(11-13-32(21,2)26(23)12-14-33(24,25)3)35-44-18-30(39)34-27(31(40)43-4)15-20-5-10-29(38)28(16-20)36(41)42/h5,10,16-17,23-27,36,38,41H,6-9,11-15,18H2,1-4H3,(H,34,39) |
| InChIKey | YLOPQWXZMRTKQX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|