C32H43N3O8 — CID 163171864
3-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-2-carboxy-1-hydroxyethyl]-N-hydroxybenzeneamine oxide (PubChem CID 163171864) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is 3-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-2-carboxy-1-hydroxyethyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-2-carboxy-1-hydroxyethyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163171864 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 3-[2-[[2-[(17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]oxyacetyl]amino]-2-carboxy-1-hydroxyethyl]-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)C1CCC2C3CCC4=CC(=NOCC(=O)NC(C(=O)O)C(O)c5cccc([NH+]([O-])O)c5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H43N3O8/c1-18(36)24-9-10-25-23-8-7-20-16-21(11-13-31(20,2)26(23)12-14-32(24,25)3)34-43-17-27(37)33-28(30(39)40)29(38)19-5-4-6-22(15-19)35(41)42/h4-6,15-16,23-26,28-29,35,38,41H,7-14,17H2,1-3H3,(H,33,37)(H,39,40) |
| InChIKey | VROHOVRHNUJUPF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 173.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|