C21H23O10+ — CID 163181276
2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-8aH-chromen-1-ium-5-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163181276) has the molecular formula C21H23O10+ and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-8aH-chromen-1-ium-5-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-8aH-chromen-1-ium-5-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163181276 |
| Molecular Formula | C21H23O10+ |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[[2-(3,4-dihydroxyphenyl)-7-hydroxy-8aH-chromen-1-ium-5-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1OC(OC2=CC(O)=CC3[OH+]C(c4ccc(O)c(O)c4)=CC=C23)C(O)C(O)C1O |
| InChI | InChI=1S/C21H22O10/c22-8-17-18(26)19(27)20(28)21(31-17)30-16-7-10(23)6-15-11(16)2-4-14(29-15)9-1-3-12(24)13(25)5-9/h1-7,15,17-28H,8H2/p+1 |
| InChIKey | ZEPPNEKSNREXAS-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|