C25H28O13 — CID 163182111
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxy-5-methyl-2-oxochromen-8-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 163182111) has the molecular formula C25H28O13 and a molecular weight of 536.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxy-5-methyl-2-oxochromen-8-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxy-5-methyl-2-oxochromen-8-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163182111 |
| Molecular Formula | C25H28O13 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-methoxy-5-methyl-2-oxochromen-8-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | COc1cc(=O)oc2c(O[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc(C)c12 |
| InChI | InChI=1S/C25H28O13/c1-11-7-8-16(21-20(11)17(31-6)9-19(30)38-21)36-25-24(35-15(5)29)23(34-14(4)28)22(33-13(3)27)18(37-25)10-32-12(2)26/h7-9,18,22-25H,10H2,1-6H3/t18-,22-,23+,24-,25-/m1/s1 |
| InChIKey | ZMTMNTNLJXAWRG-GOZZSVHWSA-N |
| XLogP | 1.57 |
| TPSA | 163.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|