C16H14O10 — CID 163182420
(2R,3R,4R)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid (PubChem CID 163182420) has the molecular formula C16H14O10 and a molecular weight of 366.28 g/mol. Its IUPAC name is (2R,3R,4R)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid.
| Compound Name | (2R,3R,4R)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 163182420 |
| Molecular Formula | C16H14O10 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (2R,3R,4R)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@@H]1C=C(C(=O)O)O[C@@H](C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C16H14O10/c17-8-3-1-7(5-9(8)18)2-4-12(19)25-10-6-11(15(21)22)26-14(13(10)20)16(23)24/h1-6,10,13-14,17-18,20H,(H,21,22)(H,23,24)/t10-,13-,14-/m1/s1 |
| InChIKey | ZQFOLQKZDARIIB-LERXQTSPSA-N |
| XLogP | -0.16 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|