C15H14O10 — CID 162960322
(2S)-2-[(2R,3R,4R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid (PubChem CID 162960322) has the molecular formula C15H14O10 and a molecular weight of 354.27 g/mol. Its IUPAC name is (2S)-2-[(2R,3R,4R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid.
| Compound Name | (2S)-2-[(2R,3R,4R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 162960322 |
| Molecular Formula | C15H14O10 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (2S)-2-[(2R,3R,4R)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@H]1[C@@H]([C@H](O)C(=O)O)OC(=O)[C@@H]1O |
| InChI | InChI=1S/C15H14O10/c16-7-3-1-6(5-8(7)17)2-4-9(18)24-13-11(20)15(23)25-12(13)10(19)14(21)22/h1-5,10-13,16-17,19-20H,(H,21,22)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | WQNVWUUZUSFRLX-UMSGYPCISA-N |
| XLogP | -1.25 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|