C29H40O5 — CID 163184243
(3,7-dimethyl-6,8-dioxoisochromen-7-yl) (9E,12E)-octadeca-9,12-dienoate (PubChem CID 163184243) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (9E,12E)-octadeca-9,12-dienoate.
| Compound Name | (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (9E,12E)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 163184243 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (3,7-dimethyl-6,8-dioxoisochromen-7-yl) (9E,12E)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC1(C)C(=O)C=C2C=C(C)OC=C2C1=O |
| InChI | InChI=1S/C29H40O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-27(31)34-29(3)26(30)21-24-20-23(2)33-22-25(24)28(29)32/h8-9,11-12,20-22H,4-7,10,13-19H2,1-3H3/b9-8+,12-11+ |
| InChIKey | PEXQKYJISMRMBZ-MVKOLZDDSA-N |
| XLogP | 7.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|