C24H26O6 — CID 163185722
(2R,3S,4S,5S,6S)-2-methyl-6-[4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenoxy]oxane-3,4,5-triol (PubChem CID 163185722) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-methyl-6-[4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-methyl-6-[4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163185722 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-methyl-6-[4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenoxy]oxane-3,4,5-triol |
| SMILES | C/C=C/c1ccc2oc(-c3ccc(O[C@@H]4O[C@H](C)[C@@H](O)[C@H](O)[C@@H]4O)cc3)c(C)c2c1 |
| InChI | InChI=1S/C24H26O6/c1-4-5-15-6-11-19-18(12-15)13(2)23(30-19)16-7-9-17(10-8-16)29-24-22(27)21(26)20(25)14(3)28-24/h4-12,14,20-22,24-27H,1-3H3/b5-4+/t14-,20-,21+,22+,24+/m1/s1 |
| InChIKey | TWGHXVKHVUGVCO-LGFCNULLSA-N |
| XLogP | 3.65 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |