C15H20O4 — CID 163186586
(2S)-2-hydroxy-3-methyl-4-[(E,3S)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one (PubChem CID 163186586) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-methyl-4-[(E,3S)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one.
| Compound Name | (2S)-2-hydroxy-3-methyl-4-[(E,3S)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163186586 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2S)-2-hydroxy-3-methyl-4-[(E,3S)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one |
| SMILES | C=C(C)[C@H](/C=C/C1=C(C)[C@@H](O)OC1=O)CCC(C)=O |
| InChI | InChI=1S/C15H20O4/c1-9(2)12(6-5-10(3)16)7-8-13-11(4)14(17)19-15(13)18/h7-8,12,14,17H,1,5-6H2,2-4H3/b8-7+/t12-,14-/m0/s1 |
| InChIKey | QGRSEQLIFLUHGN-FCSZMHKNSA-N |
| XLogP | 2.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|