C10H16O2 — CID 163189390
1-[(2S)-3,3-dimethyloxiran-2-yl]-2,2-dimethylbut-3-en-1-one (PubChem CID 163189390) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[(2S)-3,3-dimethyloxiran-2-yl]-2,2-dimethylbut-3-en-1-one.
| Compound Name | 1-[(2S)-3,3-dimethyloxiran-2-yl]-2,2-dimethylbut-3-en-1-one |
|---|---|
| PubChem CID | 163189390 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-[(2S)-3,3-dimethyloxiran-2-yl]-2,2-dimethylbut-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)[C@H]1OC1(C)C |
| InChI | InChI=1S/C10H16O2/c1-6-9(2,3)7(11)8-10(4,5)12-8/h6,8H,1H2,2-5H3/t8-/m1/s1 |
| InChIKey | VDWHYKNCKVKWIG-MRVPVSSYSA-N |
| XLogP | 1.95 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|