C25H34N2O6 — CID 163190978
(1S,2R,3R,6E,7S,8R,9S,10S)-6-ethylidene-3,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid (PubChem CID 163190978) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is (1S,2R,3R,6E,7S,8R,9S,10S)-6-ethylidene-3,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,6E,7S,8R,9S,10S)-6-ethylidene-3,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 163190978 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (1S,2R,3R,6E,7S,8R,9S,10S)-6-ethylidene-3,9,13-trihydroxy-11,20-dimethyl-8-propan-2-yl-4-oxa-11,20-diazapentacyclo[8.7.3.01,10.02,7.012,17]icosa-12(17),13,15-triene-2-carboxylic acid |
| SMILES | C/C=C1/CO[C@@H](O)[C@@]2(C(=O)O)[C@H]1[C@@H](C(C)C)[C@H](O)[C@]13N(C)CC[C@]21c1cccc(O)c1N3C |
| InChI | InChI=1S/C25H34N2O6/c1-6-14-12-33-22(32)24(21(30)31)18(14)17(13(2)3)20(29)25-23(24,10-11-26(25)4)15-8-7-9-16(28)19(15)27(25)5/h6-9,13,17-18,20,22,28-29,32H,10-12H2,1-5H3,(H,30,31)/b14-6+/t17-,18-,20+,22-,23+,24+,25-/m1/s1 |
| InChIKey | LNFKALZNQFQNIB-PHJIDTPPSA-N |
| XLogP | 1.74 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|