C36H42N4O — CID 163191558
(1S,2R,4R,10R,12R,13R)-26-(9H-pyrido[3,4-b]indol-1-yl)-28-oxa-3,16-diazahexacyclo[11.11.2.11,4.112,16.02,12.03,10]octacosa-8,21,25-triene (PubChem CID 163191558) has the molecular formula C36H42N4O and a molecular weight of 546.76 g/mol. Its IUPAC name is (1S,2R,4R,10R,12R,13R)-26-(9H-pyrido[3,4-b]indol-1-yl)-28-oxa-3,16-diazahexacyclo[11.11.2.11,4.112,16.02,12.03,10]octacosa-8,21,25-triene.
| Compound Name | (1S,2R,4R,10R,12R,13R)-26-(9H-pyrido[3,4-b]indol-1-yl)-28-oxa-3,16-diazahexacyclo[11.11.2.11,4.112,16.02,12.03,10]octacosa-8,21,25-triene |
|---|---|
| PubChem CID | 163191558 |
| Molecular Formula | C36H42N4O |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | (1S,2R,4R,10R,12R,13R)-26-(9H-pyrido[3,4-b]indol-1-yl)-28-oxa-3,16-diazahexacyclo[11.11.2.11,4.112,16.02,12.03,10]octacosa-8,21,25-triene |
| SMILES | C1=CCC[C@@]23C=C(c4nccc5c4[nH]c4ccccc45)[C@@H]4CCN(CCCC1)C[C@@]41C[C@@H]4C=CCCC[C@@H](O2)N4[C@H]13 |
| InChI | InChI=1S/C36H42N4O/c1-2-4-11-20-39-21-17-29-28(32-33-27(16-19-37-32)26-13-8-9-14-30(26)38-33)23-36(18-10-3-1)34-35(29,24-39)22-25-12-6-5-7-15-31(41-36)40(25)34/h1,3,6,8-9,12-14,16,19,23,25,29,31,34,38H,2,4-5,7,10-11,15,17-18,20-22,24H2/t25-,29-,31+,34+,35-,36-/m0/s1 |
| InChIKey | NAVXLCDGOVBCCD-NRCFEVRZSA-N |
| XLogP | 7.22 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|