C21H32O3 — CID 163191584
[(1S,6R,7aR)-6-[(1Z)-1-(2,2-dimethylcyclopentylidene)ethyl]-7,7-dimethyl-4,5,6,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate (PubChem CID 163191584) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [(1S,6R,7aR)-6-[(1Z)-1-(2,2-dimethylcyclopentylidene)ethyl]-7,7-dimethyl-4,5,6,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate.
| Compound Name | [(1S,6R,7aR)-6-[(1Z)-1-(2,2-dimethylcyclopentylidene)ethyl]-7,7-dimethyl-4,5,6,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 163191584 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(1S,6R,7aR)-6-[(1Z)-1-(2,2-dimethylcyclopentylidene)ethyl]-7,7-dimethyl-4,5,6,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC=C2CC[C@@H](/C(C)=C3/CCCC3(C)C)C(C)(C)[C@H]21 |
| InChI | InChI=1S/C21H32O3/c1-13(16-8-7-11-20(16,3)4)17-10-9-15-12-23-19(24-14(2)22)18(15)21(17,5)6/h12,17-19H,7-11H2,1-6H3/b16-13-/t17-,18+,19-/m0/s1 |
| InChIKey | IMIAJJXGLPJMII-UINMVVPXSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|