C29H44O4 — CID 163193908
(1S,2S,4S,5R,8R,10S,13R,14R,16S,17S,18R,20R)-10,16-dihydroxy-4,5,9,9,13,20-hexamethyl-24-oxaheptacyclo[15.5.2.01,18.02,20.04,17.05,14.08,13]tetracosan-23-one (PubChem CID 163193908) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is (1S,2S,4S,5R,8R,10S,13R,14R,16S,17S,18R,20R)-10,16-dihydroxy-4,5,9,9,13,20-hexamethyl-24-oxaheptacyclo[15.5.2.01,18.02,20.04,17.05,14.08,13]tetracosan-23-one.
| Compound Name | (1S,2S,4S,5R,8R,10S,13R,14R,16S,17S,18R,20R)-10,16-dihydroxy-4,5,9,9,13,20-hexamethyl-24-oxaheptacyclo[15.5.2.01,18.02,20.04,17.05,14.08,13]tetracosan-23-one |
|---|---|
| PubChem CID | 163193908 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (1S,2S,4S,5R,8R,10S,13R,14R,16S,17S,18R,20R)-10,16-dihydroxy-4,5,9,9,13,20-hexamethyl-24-oxaheptacyclo[15.5.2.01,18.02,20.04,17.05,14.08,13]tetracosan-23-one |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3C[C@H](O)[C@]45OC(=O)[C@]67CC[C@](C)(CC46)[C@@H]7C[C@@]5(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H44O4/c1-23(2)16-7-10-26(5)17(25(16,4)9-8-20(23)30)13-21(31)29-19-14-24(3)11-12-28(19,22(32)33-29)18(24)15-27(26,29)6/h16-21,30-31H,7-15H2,1-6H3/t16-,17+,18-,19?,20-,21-,24+,25-,26+,27-,28-,29+/m0/s1 |
| InChIKey | YRROXDJRDFXNKD-SZNYPQGZSA-N |
| XLogP | 5.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |