C33H48O6 — CID 163194411
methyl (3S)-3-[(2R,3R,8S)-5-hydroxy-2,3-dimethyl-8-(3-methylbut-2-enyl)-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-4,7-dioxo-2,3-dihydrochromen-6-yl]hexanoate (PubChem CID 163194411) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is methyl (3S)-3-[(2R,3R,8S)-5-hydroxy-2,3-dimethyl-8-(3-methylbut-2-enyl)-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-4,7-dioxo-2,3-dihydrochromen-6-yl]hexanoate.
| Compound Name | methyl (3S)-3-[(2R,3R,8S)-5-hydroxy-2,3-dimethyl-8-(3-methylbut-2-enyl)-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-4,7-dioxo-2,3-dihydrochromen-6-yl]hexanoate |
|---|---|
| PubChem CID | 163194411 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | methyl (3S)-3-[(2R,3R,8S)-5-hydroxy-2,3-dimethyl-8-(3-methylbut-2-enyl)-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-4,7-dioxo-2,3-dihydrochromen-6-yl]hexanoate |
| SMILES | C=C(C)[C@H](CC=C(C)C)C[C@]1(CC=C(C)C)C(=O)C([C@@H](CCC)CC(=O)OC)=C(O)C2=C1O[C@H](C)[C@@H](C)C2=O |
| InChI | InChI=1S/C33H48O6/c1-11-12-24(17-26(34)38-10)27-30(36)28-29(35)22(8)23(9)39-32(28)33(31(27)37,16-15-20(4)5)18-25(21(6)7)14-13-19(2)3/h13,15,22-25,36H,6,11-12,14,16-18H2,1-5,7-10H3/t22-,23-,24+,25-,33-/m1/s1 |
| InChIKey | QDPQKBRQKKSJRJ-QDYUQMBUSA-N |
| XLogP | 7.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|