C30H48N2O2 — CID 163194696
(2S,3S,4E,6E,10Z,13Z,16Z,19Z,22Z,26E,28S,29S)-2,29-diaminotriaconta-4,6,10,13,16,19,22,26-octaene-3,28-diol (PubChem CID 163194696) has the molecular formula C30H48N2O2 and a molecular weight of 468.73 g/mol. Its IUPAC name is (2S,3S,4E,6E,10Z,13Z,16Z,19Z,22Z,26E,28S,29S)-2,29-diaminotriaconta-4,6,10,13,16,19,22,26-octaene-3,28-diol.
| Compound Name | (2S,3S,4E,6E,10Z,13Z,16Z,19Z,22Z,26E,28S,29S)-2,29-diaminotriaconta-4,6,10,13,16,19,22,26-octaene-3,28-diol |
|---|---|
| PubChem CID | 163194696 |
| Molecular Formula | C30H48N2O2 |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.37 |
| IUPAC Name | (2S,3S,4E,6E,10Z,13Z,16Z,19Z,22Z,26E,28S,29S)-2,29-diaminotriaconta-4,6,10,13,16,19,22,26-octaene-3,28-diol |
| SMILES | C[C@H](N)[C@@H](O)/C=C/C=C/CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C30H48N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h3,5-6,8-9,11-12,14-15,17,20,22-30,33-34H,4,7,10,13,16,18-19,21,31-32H2,1-2H3/b5-3-,8-6-,11-9-,14-12-,17-15-,22-20+,25-23+,26-24+/t27-,28-,29-,30-/m0/s1 |
| InChIKey | WVXXLSBPRGHRHS-MADRGNLTSA-N |
| XLogP | 5.97 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|