C41H70O2 — CID 163201266
(5Z,10R,13E,15E,17E,23R,26Z)-2-methoxy-2,6,10,14,23,27,31-heptamethyl-19-methylidenedotriaconta-5,13,15,17,26-pentaen-3-one (PubChem CID 163201266) has the molecular formula C41H70O2 and a molecular weight of 595.01 g/mol. Its IUPAC name is (5Z,10R,13E,15E,17E,23R,26Z)-2-methoxy-2,6,10,14,23,27,31-heptamethyl-19-methylidenedotriaconta-5,13,15,17,26-pentaen-3-one.
| Compound Name | (5Z,10R,13E,15E,17E,23R,26Z)-2-methoxy-2,6,10,14,23,27,31-heptamethyl-19-methylidenedotriaconta-5,13,15,17,26-pentaen-3-one |
|---|---|
| PubChem CID | 163201266 |
| Molecular Formula | C41H70O2 |
| Molecular Weight | 595.01 g/mol |
| Exact Mass | 594.54 |
| IUPAC Name | (5Z,10R,13E,15E,17E,23R,26Z)-2-methoxy-2,6,10,14,23,27,31-heptamethyl-19-methylidenedotriaconta-5,13,15,17,26-pentaen-3-one |
| SMILES | C=C(/C=C/C=C/C(C)=C/CC[C@H](C)CCC/C(C)=C\CC(=O)C(C)(C)OC)CCC[C@@H](C)CC/C=C(/C)CCCC(C)C |
| InChI | InChI=1S/C41H70O2/c1-33(2)19-14-22-36(5)25-17-28-37(6)26-15-23-34(3)20-12-13-21-35(4)24-16-27-38(7)29-18-30-39(8)31-32-40(42)41(9,10)43-11/h12-13,20-21,24-25,31,33,37-38H,3,14-19,22-23,26-30,32H2,1-2,4-11H3/b20-12+,21-13+,35-24+,36-25-,39-31-/t37-,38+/m1/s1 |
| InChIKey | FPSCIJGYAKLEEP-XOFQIBFMSA-N |
| XLogP | 12.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.01 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|