C41H78O2 — CID 75815418
(5E,10S,13E,23S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13-dien-3-one (PubChem CID 75815418) has the molecular formula C41H78O2 and a molecular weight of 603.07 g/mol. Its IUPAC name is (5E,10S,13E,23S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13-dien-3-one.
| Compound Name | (5E,10S,13E,23S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13-dien-3-one |
|---|---|
| PubChem CID | 75815418 |
| Molecular Formula | C41H78O2 |
| Molecular Weight | 603.07 g/mol |
| Exact Mass | 602.60 |
| IUPAC Name | (5E,10S,13E,23S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13-dien-3-one |
| SMILES | COC(C)(C)C(=O)C/C=C(\C)CCC[C@H](C)CC/C=C(\C)CCCCC(C)CCC[C@H](C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C41H78O2/c1-33(2)19-14-22-36(5)25-17-28-37(6)26-15-23-34(3)20-12-13-21-35(4)24-16-27-38(7)29-18-30-39(8)31-32-40(42)41(9,10)43-11/h24,31,33-34,36-38H,12-23,25-30,32H2,1-11H3/b35-24+,39-31+/t34?,36?,37-,38+/m0/s1 |
| InChIKey | UITGVIFBDHZCKO-IILSYSDCSA-N |
| XLogP | 13.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.07 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|