C41H76O2 — CID 56835769
(5E,13E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13,30-trien-3-one (PubChem CID 56835769) has the molecular formula C41H76O2 and a molecular weight of 601.06 g/mol. Its IUPAC name is (5E,13E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13,30-trien-3-one.
| Compound Name | (5E,13E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13,30-trien-3-one |
|---|---|
| PubChem CID | 56835769 |
| Molecular Formula | C41H76O2 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.58 |
| IUPAC Name | (5E,13E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-5,13,30-trien-3-one |
| SMILES | COC(C)(C)C(=O)C/C=C(\C)CCCC(C)CC/C=C(\C)CCCCC(C)CCC[C@H](C)CCC[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C41H76O2/c1-33(2)19-14-22-36(5)25-17-28-37(6)26-15-23-34(3)20-12-13-21-35(4)24-16-27-38(7)29-18-30-39(8)31-32-40(42)41(9,10)43-11/h19,24,31,34,36-38H,12-18,20-23,25-30,32H2,1-11H3/b35-24+,39-31+/t34?,36-,37+,38?/m1/s1 |
| InChIKey | BCUZFDMYPNQSSU-NGHFYCNASA-N |
| XLogP | 13.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|