C20H40O3 — CID 163205871
(Z)-6,6-diheptoxyhex-3-en-1-ol (PubChem CID 163205871) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is (Z)-6,6-diheptoxyhex-3-en-1-ol.
| Compound Name | (Z)-6,6-diheptoxyhex-3-en-1-ol |
|---|---|
| PubChem CID | 163205871 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | (Z)-6,6-diheptoxyhex-3-en-1-ol |
| SMILES | CCCCCCCOC(C/C=C\CCO)OCCCCCCC |
| InChI | InChI=1S/C20H40O3/c1-3-5-7-9-14-18-22-20(16-12-11-13-17-21)23-19-15-10-8-6-4-2/h11-12,20-21H,3-10,13-19H2,1-2H3/b12-11- |
| InChIKey | ZCXFKABLVYZTQL-QXMHVHEDSA-N |
| XLogP | 5.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|