C11H11ClLiNO3 — CID 163206826
lithium 2-chloro-3-[3-(hydroxymethyl)azetidin-1-yl]benzoate (PubChem CID 163206826) has the molecular formula C11H11ClLiNO3 and a molecular weight of 247.61 g/mol. Its IUPAC name is lithium 2-chloro-3-[3-(hydroxymethyl)azetidin-1-yl]benzoate.
| Compound Name | lithium 2-chloro-3-[3-(hydroxymethyl)azetidin-1-yl]benzoate |
|---|---|
| PubChem CID | 163206826 |
| Molecular Formula | C11H11ClLiNO3 |
| Molecular Weight | 247.61 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | lithium 2-chloro-3-[3-(hydroxymethyl)azetidin-1-yl]benzoate |
| SMILES | O=C([O-])c1cccc(N2CC(CO)C2)c1Cl.[Li+] |
| InChI | InChI=1S/C11H12ClNO3.Li/c12-10-8(11(15)16)2-1-3-9(10)13-4-7(5-13)6-14;/h1-3,7,14H,4-6H2,(H,15,16);/q;+1/p-1 |
| InChIKey | OOQOGFDYFUJKKZ-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.61 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |