About (E)-icos-11-enoic acid;hydrate
(E)-icos-11-enoic acid;hydrate (PubChem CID 163207099) has the molecular formula C20H40O3
and a molecular weight of 328.54 g/mol. Its IUPAC name is (E)-icos-11-enoic acid;hydrate.
Molecular Properties
| Compound Name | (E)-icos-11-enoic acid;hydrate |
| PubChem CID | 163207099 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | (E)-icos-11-enoic acid;hydrate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)O.O |
| InChI | InChI=1S/C20H38O2.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h9-10H,2-8,11-19H2,1H3,(H,21,22);1H2/b10-9+; |
| InChIKey | RCQDALQVJIZALJ-RRABGKBLSA-N |
| XLogP | 6.06 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-icos-11-enoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-icos-11-enoic acid;hydrate?
The IUPAC name of (E)-icos-11-enoic acid;hydrate (CID 163207099) is (E)-icos-11-enoic acid;hydrate.
What is the SMILES notation for (E)-icos-11-enoic acid;hydrate?
The canonical SMILES for (E)-icos-11-enoic acid;hydrate is CCCCCCCC/C=C/CCCCCCCCCC(=O)O.O.
What is the InChIKey of (E)-icos-11-enoic acid;hydrate?
The InChIKey is RCQDALQVJIZALJ-RRABGKBLSA-N. The full InChI is InChI=1S/C20H38O2.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h9-10H,2-8,11-19H2,1H3,(H,21,22);1H2/b10-9+;.
What are the key properties of (E)-icos-11-enoic acid;hydrate?
(E)-icos-11-enoic acid;hydrate has a molecular weight of 328.54 g/mol, XLogP of 6.06, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-icos-11-enoic acid;hydrate is sourced from PubChem (CID 163207099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).