C24H25IO7S — CID 163207554
[(2S,3S,4R,5R)-4,5-diacetyloxy-6-[2-(2-iodophenyl)phenyl]sulfanyl-2-methyloxan-3-yl] acetate (PubChem CID 163207554) has the molecular formula C24H25IO7S and a molecular weight of 584.43 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4,5-diacetyloxy-6-[2-(2-iodophenyl)phenyl]sulfanyl-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-6-[2-(2-iodophenyl)phenyl]sulfanyl-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 163207554 |
| Molecular Formula | C24H25IO7S |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-6-[2-(2-iodophenyl)phenyl]sulfanyl-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(Sc2ccccc2-c2ccccc2I)O[C@H]1C |
| InChI | InChI=1S/C24H25IO7S/c1-13-21(30-14(2)26)22(31-15(3)27)23(32-16(4)28)24(29-13)33-20-12-8-6-10-18(20)17-9-5-7-11-19(17)25/h5-13,21-24H,1-4H3/t13-,21-,22+,23+,24?/m0/s1 |
| InChIKey | AMJRDRJWFAOCBK-DGRNATHOSA-N |
| XLogP | 4.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|