C19H25BrN2O3 — CID 163210338
tert-butyl N-[5-bromo-2-(3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl)phenyl]-N-methylcarbamate (PubChem CID 163210338) has the molecular formula C19H25BrN2O3 and a molecular weight of 409.32 g/mol. Its IUPAC name is tert-butyl N-[5-bromo-2-(3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl)phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-bromo-2-(3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163210338 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | tert-butyl N-[5-bromo-2-(3-oxo-3-pyrrolidin-1-ylprop-1-en-2-yl)phenyl]-N-methylcarbamate |
| SMILES | C=C(C(=O)N1CCCC1)c1ccc(Br)cc1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25BrN2O3/c1-13(17(23)22-10-6-7-11-22)15-9-8-14(20)12-16(15)21(5)18(24)25-19(2,3)4/h8-9,12H,1,6-7,10-11H2,2-5H3 |
| InChIKey | CHZDJRBLNBRVSZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|