C13H18BrClFN3O2 — CID 169430160
tert-butyl N-[[amino-(4-bromo-2-fluorophenyl)methylidene]amino]-N-methylcarbamate;hydrochloride (PubChem CID 169430160) has the molecular formula C13H18BrClFN3O2 and a molecular weight of 382.66 g/mol. Its IUPAC name is tert-butyl N-[[amino-(4-bromo-2-fluorophenyl)methylidene]amino]-N-methylcarbamate;hydrochloride.
| Compound Name | tert-butyl N-[[amino-(4-bromo-2-fluorophenyl)methylidene]amino]-N-methylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 169430160 |
| Molecular Formula | C13H18BrClFN3O2 |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | tert-butyl N-[[amino-(4-bromo-2-fluorophenyl)methylidene]amino]-N-methylcarbamate;hydrochloride |
| SMILES | CN(N=C(N)c1ccc(Br)cc1F)C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C13H17BrFN3O2.ClH/c1-13(2,3)20-12(19)18(4)17-11(16)9-6-5-8(14)7-10(9)15;/h5-7H,1-4H3,(H2,16,17);1H |
| InChIKey | HRCNMUDLZAJGCW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|