C11H19FN2O2 — CID 163211522
3-(6-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 163211522) has the molecular formula C11H19FN2O2 and a molecular weight of 230.28 g/mol. Its IUPAC name is 3-(6-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(6-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 163211522 |
| Molecular Formula | C11H19FN2O2 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(6-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CN1CCC2NCC(F)C21)C(=O)O |
| InChI | InChI=1S/C11H19FN2O2/c1-11(2,10(15)16)6-14-4-3-8-9(14)7(12)5-13-8/h7-9,13H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | IHQLDEUUCAFBMF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |